C12H13N3O6S2 — CID 163208614
1-amino-4-phenyldiazenylcyclohexa-3,5-diene-1,3-disulfonic acid (PubChem CID 163208614) has the molecular formula C12H13N3O6S2 and a molecular weight of 359.39 g/mol. Its IUPAC name is 1-amino-4-phenyldiazenylcyclohexa-3,5-diene-1,3-disulfonic acid.
| Compound Name | 1-amino-4-phenyldiazenylcyclohexa-3,5-diene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 163208614 |
| Molecular Formula | C12H13N3O6S2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 1-amino-4-phenyldiazenylcyclohexa-3,5-diene-1,3-disulfonic acid |
| SMILES | NC1(S(=O)(=O)O)C=CC(/N=N/c2ccccc2)=C(S(=O)(=O)O)C1 |
| InChI | InChI=1S/C12H13N3O6S2/c13-12(23(19,20)21)7-6-10(11(8-12)22(16,17)18)15-14-9-4-2-1-3-5-9/h1-7H,8,13H2,(H,16,17,18)(H,19,20,21)/b15-14+ |
| InChIKey | ZRLPNBXESJRTHK-CCEZHUSRSA-N |
| XLogP | 1.37 |
| TPSA | 159.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|