About 2-[(4-methyl-2-oxo-3,4-dihydrochromen-7-yl)amino]acetonitrile
2-[(4-methyl-2-oxo-3,4-dihydrochromen-7-yl)amino]acetonitrile (PubChem CID 163209070) has the molecular formula C12H12N2O2
and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-[(4-methyl-2-oxo-3,4-dihydrochromen-7-yl)amino]acetonitrile.
Molecular Properties
| Compound Name | 2-[(4-methyl-2-oxo-3,4-dihydrochromen-7-yl)amino]acetonitrile |
| PubChem CID | 163209070 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-[(4-methyl-2-oxo-3,4-dihydrochromen-7-yl)amino]acetonitrile |
| SMILES | CC1CC(=O)Oc2cc(NCC#N)ccc21 |
| InChI | InChI=1S/C12H12N2O2/c1-8-6-12(15)16-11-7-9(14-5-4-13)2-3-10(8)11/h2-3,7-8,14H,5-6H2,1H3 |
| InChIKey | AEAIRDQBGWAJLF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-methyl-2-oxo-3,4-dihydrochromen-7-yl)amino]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methyl-2-oxo-3,4-dihydrochromen-7-yl)amino]acetonitrile?
The IUPAC name of 2-[(4-methyl-2-oxo-3,4-dihydrochromen-7-yl)amino]acetonitrile (CID 163209070) is 2-[(4-methyl-2-oxo-3,4-dihydrochromen-7-yl)amino]acetonitrile.
What is the SMILES notation for 2-[(4-methyl-2-oxo-3,4-dihydrochromen-7-yl)amino]acetonitrile?
The canonical SMILES for 2-[(4-methyl-2-oxo-3,4-dihydrochromen-7-yl)amino]acetonitrile is CC1CC(=O)Oc2cc(NCC#N)ccc21.
What is the InChIKey of 2-[(4-methyl-2-oxo-3,4-dihydrochromen-7-yl)amino]acetonitrile?
The InChIKey is AEAIRDQBGWAJLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2/c1-8-6-12(15)16-11-7-9(14-5-4-13)2-3-10(8)11/h2-3,7-8,14H,5-6H2,1H3.
What are the key properties of 2-[(4-methyl-2-oxo-3,4-dihydrochromen-7-yl)amino]acetonitrile?
2-[(4-methyl-2-oxo-3,4-dihydrochromen-7-yl)amino]acetonitrile has a molecular weight of 216.24 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methyl-2-oxo-3,4-dihydrochromen-7-yl)amino]acetonitrile is sourced from PubChem (CID 163209070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).