C20H26N2SSi — CID 163209348
4-(2,4,6-trimethylphenyl)-N-(trimethylsilylmethyl)-1,3-benzothiazol-2-amine (PubChem CID 163209348) has the molecular formula C20H26N2SSi and a molecular weight of 354.60 g/mol. Its IUPAC name is 4-(2,4,6-trimethylphenyl)-N-(trimethylsilylmethyl)-1,3-benzothiazol-2-amine.
| Compound Name | 4-(2,4,6-trimethylphenyl)-N-(trimethylsilylmethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 163209348 |
| Molecular Formula | C20H26N2SSi |
| Molecular Weight | 354.60 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 4-(2,4,6-trimethylphenyl)-N-(trimethylsilylmethyl)-1,3-benzothiazol-2-amine |
| SMILES | Cc1cc(C)c(-c2cccc3sc(NC[Si](C)(C)C)nc23)c(C)c1 |
| InChI | InChI=1S/C20H26N2SSi/c1-13-10-14(2)18(15(3)11-13)16-8-7-9-17-19(16)22-20(23-17)21-12-24(4,5)6/h7-11H,12H2,1-6H3,(H,21,22) |
| InChIKey | CYXANOLBOVDUTP-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.60 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|