C20H19N5O2 — CID 163210465
4-[4-[5-(hydroxymethyl)furan-2-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexane-1-carbonitrile (PubChem CID 163210465) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is 4-[4-[5-(hydroxymethyl)furan-2-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexane-1-carbonitrile.
| Compound Name | 4-[4-[5-(hydroxymethyl)furan-2-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 163210465 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 4-[4-[5-(hydroxymethyl)furan-2-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexane-1-carbonitrile |
| SMILES | N#CC1CCC(n2c(-c3ccc(CO)o3)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C20H19N5O2/c21-9-12-1-3-13(4-2-12)25-18-15-7-8-22-19(15)23-10-16(18)24-20(25)17-6-5-14(11-26)27-17/h5-8,10,12-13,26H,1-4,11H2,(H,22,23) |
| InChIKey | WVLOPOJHGRXSHU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 103.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |