C20H17N7O — CID 163210675
2-[4-[4-(5-methylfuran-2-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]butanenitrile (PubChem CID 163210675) has the molecular formula C20H17N7O and a molecular weight of 371.40 g/mol. Its IUPAC name is 2-[4-[4-(5-methylfuran-2-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]butanenitrile.
| Compound Name | 2-[4-[4-(5-methylfuran-2-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 163210675 |
| Molecular Formula | C20H17N7O |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-[4-[4-(5-methylfuran-2-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]butanenitrile |
| SMILES | CCC(C#N)n1cc(-n2c(-c3ccc(C)o3)nc3cnc4[nH]ccc4c32)cn1 |
| InChI | InChI=1S/C20H17N7O/c1-3-13(8-21)26-11-14(9-24-26)27-18-15-6-7-22-19(15)23-10-16(18)25-20(27)17-5-4-12(2)28-17/h4-7,9-11,13H,3H2,1-2H3,(H,22,23) |
| InChIKey | KFBOCJJKPIGPLF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 101.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |