C9H13N5O2S — CID 163210881
2-[3-(4-aminopyrazol-1-yl)-1-methylsulfonylazetidin-3-yl]acetonitrile (PubChem CID 163210881) has the molecular formula C9H13N5O2S and a molecular weight of 255.30 g/mol. Its IUPAC name is 2-[3-(4-aminopyrazol-1-yl)-1-methylsulfonylazetidin-3-yl]acetonitrile.
| Compound Name | 2-[3-(4-aminopyrazol-1-yl)-1-methylsulfonylazetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 163210881 |
| Molecular Formula | C9H13N5O2S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-[3-(4-aminopyrazol-1-yl)-1-methylsulfonylazetidin-3-yl]acetonitrile |
| SMILES | CS(=O)(=O)N1CC(CC#N)(n2cc(N)cn2)C1 |
| InChI | InChI=1S/C9H13N5O2S/c1-17(15,16)13-6-9(7-13,2-3-10)14-5-8(11)4-12-14/h4-5H,2,6-7,11H2,1H3 |
| InChIKey | IMGRDMBTUAGKNQ-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |