About 3-oxobut-1-en-2-yl adamantane-1-carboxylate
3-oxobut-1-en-2-yl adamantane-1-carboxylate (PubChem CID 163211245) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is 3-oxobut-1-en-2-yl adamantane-1-carboxylate.
Molecular Properties
| Compound Name | 3-oxobut-1-en-2-yl adamantane-1-carboxylate |
| PubChem CID | 163211245 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 3-oxobut-1-en-2-yl adamantane-1-carboxylate |
| SMILES | C=C(OC(=O)C12CC3CC(CC(C3)C1)C2)C(C)=O |
| InChI | InChI=1S/C15H20O3/c1-9(16)10(2)18-14(17)15-6-11-3-12(7-15)5-13(4-11)8-15/h11-13H,2-8H2,1H3 |
| InChIKey | YNPSIKVVYYWHTR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-oxobut-1-en-2-yl adamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxobut-1-en-2-yl adamantane-1-carboxylate?
The IUPAC name of 3-oxobut-1-en-2-yl adamantane-1-carboxylate (CID 163211245) is 3-oxobut-1-en-2-yl adamantane-1-carboxylate.
What is the SMILES notation for 3-oxobut-1-en-2-yl adamantane-1-carboxylate?
The canonical SMILES for 3-oxobut-1-en-2-yl adamantane-1-carboxylate is C=C(OC(=O)C12CC3CC(CC(C3)C1)C2)C(C)=O.
What is the InChIKey of 3-oxobut-1-en-2-yl adamantane-1-carboxylate?
The InChIKey is YNPSIKVVYYWHTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c1-9(16)10(2)18-14(17)15-6-11-3-12(7-15)5-13(4-11)8-15/h11-13H,2-8H2,1H3.
What are the key properties of 3-oxobut-1-en-2-yl adamantane-1-carboxylate?
3-oxobut-1-en-2-yl adamantane-1-carboxylate has a molecular weight of 248.32 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxobut-1-en-2-yl adamantane-1-carboxylate is sourced from PubChem (CID 163211245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).