About 2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-diol
2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-diol (PubChem CID 163211256) has the molecular formula C13H16N2O4
and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-diol.
Molecular Properties
| Compound Name | 2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-diol |
| PubChem CID | 163211256 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-diol |
| SMILES | Oc1c2ccccc2c(O)n1C1CCC(O)NC1O |
| InChI | InChI=1S/C13H16N2O4/c16-10-6-5-9(11(17)14-10)15-12(18)7-3-1-2-4-8(7)13(15)19/h1-4,9-11,14,16-19H,5-6H2 |
| InChIKey | AFAWSEKELZJBTF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-diol?
The IUPAC name of 2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-diol (CID 163211256) is 2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-diol.
What is the SMILES notation for 2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-diol?
The canonical SMILES for 2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-diol is Oc1c2ccccc2c(O)n1C1CCC(O)NC1O.
What is the InChIKey of 2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-diol?
The InChIKey is AFAWSEKELZJBTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O4/c16-10-6-5-9(11(17)14-10)15-12(18)7-3-1-2-4-8(7)13(15)19/h1-4,9-11,14,16-19H,5-6H2.
What are the key properties of 2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-diol?
2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-diol has a molecular weight of 264.28 g/mol, XLogP of 0.61, 1 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dihydroxypiperidin-3-yl)isoindole-1,3-diol is sourced from PubChem (CID 163211256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).