C15H21BrN2O3 — CID 163211561
5-bromo-N-[(2R)-4-(3,3-dimethyloxiran-2-yl)-2-methylbutyl]-2-nitroaniline (PubChem CID 163211561) has the molecular formula C15H21BrN2O3 and a molecular weight of 357.25 g/mol. Its IUPAC name is 5-bromo-N-[(2R)-4-(3,3-dimethyloxiran-2-yl)-2-methylbutyl]-2-nitroaniline.
| Compound Name | 5-bromo-N-[(2R)-4-(3,3-dimethyloxiran-2-yl)-2-methylbutyl]-2-nitroaniline |
|---|---|
| PubChem CID | 163211561 |
| Molecular Formula | C15H21BrN2O3 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 5-bromo-N-[(2R)-4-(3,3-dimethyloxiran-2-yl)-2-methylbutyl]-2-nitroaniline |
| SMILES | C[C@H](CCC1OC1(C)C)CNc1cc(Br)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21BrN2O3/c1-10(4-7-14-15(2,3)21-14)9-17-12-8-11(16)5-6-13(12)18(19)20/h5-6,8,10,14,17H,4,7,9H2,1-3H3/t10-,14?/m1/s1 |
| InChIKey | IFYMRZHPJXBPND-IAPIXIRKSA-N |
| XLogP | 4.36 |
| TPSA | 67.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|