About methyl 2-[(3R)-1-(2-chloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidin-4-yl)pyrrolidin-3-yl]acetate
methyl 2-[(3R)-1-(2-chloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidin-4-yl)pyrrolidin-3-yl]acetate (PubChem CID 163211861) has the molecular formula C14H16ClF2N3O2
and a molecular weight of 331.75 g/mol. Its IUPAC name is methyl 2-[(3R)-1-(2-chloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidin-4-yl)pyrrolidin-3-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(3R)-1-(2-chloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidin-4-yl)pyrrolidin-3-yl]acetate |
| PubChem CID | 163211861 |
| Molecular Formula | C14H16ClF2N3O2 |
| Molecular Weight | 331.75 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | methyl 2-[(3R)-1-(2-chloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidin-4-yl)pyrrolidin-3-yl]acetate |
| SMILES | COC(=O)C[C@H]1CCN(c2nc(Cl)nc3c2CCC3(F)F)C1 |
| InChI | InChI=1S/C14H16ClF2N3O2/c1-22-10(21)6-8-3-5-20(7-8)12-9-2-4-14(16,17)11(9)18-13(15)19-12/h8H,2-7H2,1H3/t8-/m1/s1 |
| InChIKey | CYSSIFKOXGCDAD-MRVPVSSYSA-N |
| XLogP | 2.56 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.75 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[(3R)-1-(2-chloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidin-4-yl)pyrrolidin-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3R)-1-(2-chloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidin-4-yl)pyrrolidin-3-yl]acetate?
The IUPAC name of methyl 2-[(3R)-1-(2-chloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidin-4-yl)pyrrolidin-3-yl]acetate (CID 163211861) is methyl 2-[(3R)-1-(2-chloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidin-4-yl)pyrrolidin-3-yl]acetate.
What is the SMILES notation for methyl 2-[(3R)-1-(2-chloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidin-4-yl)pyrrolidin-3-yl]acetate?
The canonical SMILES for methyl 2-[(3R)-1-(2-chloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidin-4-yl)pyrrolidin-3-yl]acetate is COC(=O)C[C@H]1CCN(c2nc(Cl)nc3c2CCC3(F)F)C1.
What is the InChIKey of methyl 2-[(3R)-1-(2-chloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidin-4-yl)pyrrolidin-3-yl]acetate?
The InChIKey is CYSSIFKOXGCDAD-MRVPVSSYSA-N. The full InChI is InChI=1S/C14H16ClF2N3O2/c1-22-10(21)6-8-3-5-20(7-8)12-9-2-4-14(16,17)11(9)18-13(15)19-12/h8H,2-7H2,1H3/t8-/m1/s1.
What are the key properties of methyl 2-[(3R)-1-(2-chloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidin-4-yl)pyrrolidin-3-yl]acetate?
methyl 2-[(3R)-1-(2-chloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidin-4-yl)pyrrolidin-3-yl]acetate has a molecular weight of 331.75 g/mol, XLogP of 2.56, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3R)-1-(2-chloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidin-4-yl)pyrrolidin-3-yl]acetate is sourced from PubChem (CID 163211861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).