C18H26N2O5S — CID 163212882
(E)-N-[(cyclopentylamino)methylsulfonyl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 163212882) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is (E)-N-[(cyclopentylamino)methylsulfonyl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(cyclopentylamino)methylsulfonyl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 163212882 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (E)-N-[(cyclopentylamino)methylsulfonyl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)NS(=O)(=O)CNC2CCCC2)cc1OC |
| InChI | InChI=1S/C18H26N2O5S/c1-3-25-16-10-8-14(12-17(16)24-2)9-11-18(21)20-26(22,23)13-19-15-6-4-5-7-15/h8-12,15,19H,3-7,13H2,1-2H3,(H,20,21)/b11-9+ |
| InChIKey | KSMCSLWNGXRAJX-PKNBQFBNSA-N |
| XLogP | 2.04 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|