C24H28N2O2 — CID 163212907
5,6-dibutoxy-3,8-bis(ethenyl)-1,10-phenanthroline (PubChem CID 163212907) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 5,6-dibutoxy-3,8-bis(ethenyl)-1,10-phenanthroline.
| Compound Name | 5,6-dibutoxy-3,8-bis(ethenyl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 163212907 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 5,6-dibutoxy-3,8-bis(ethenyl)-1,10-phenanthroline |
| SMILES | C=Cc1cnc2c(c1)c(OCCCC)c(OCCCC)c1cc(C=C)cnc12 |
| InChI | InChI=1S/C24H28N2O2/c1-5-9-11-27-23-19-13-17(7-3)15-25-21(19)22-20(14-18(8-4)16-26-22)24(23)28-12-10-6-2/h7-8,13-16H,3-6,9-12H2,1-2H3 |
| InChIKey | IOFJKUPRCHYRJA-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|