C33H34N2O12S2 — CID 163213511
methyl 2-[5-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutylsulfanyl]-1,3,4-oxadiazol-2-yl]benzenesulfonate (PubChem CID 163213511) has the molecular formula C33H34N2O12S2 and a molecular weight of 714.77 g/mol. Its IUPAC name is methyl 2-[5-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutylsulfanyl]-1,3,4-oxadiazol-2-yl]benzenesulfonate.
| Compound Name | methyl 2-[5-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutylsulfanyl]-1,3,4-oxadiazol-2-yl]benzenesulfonate |
|---|---|
| PubChem CID | 163213511 |
| Molecular Formula | C33H34N2O12S2 |
| Molecular Weight | 714.77 g/mol |
| Exact Mass | 714.16 |
| IUPAC Name | methyl 2-[5-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutylsulfanyl]-1,3,4-oxadiazol-2-yl]benzenesulfonate |
| SMILES | COc1cc(OC)c2c(=O)c(OCCCCSc3nnc(-c4ccccc4S(=O)(=O)OC)o3)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C33H34N2O12S2/c1-39-20-17-22(40-2)27-23(18-20)46-29(19-15-24(41-3)30(43-5)25(16-19)42-4)31(28(27)36)45-13-9-10-14-48-33-35-34-32(47-33)21-11-7-8-12-26(21)49(37,38)44-6/h7-8,11-12,15-18H,9-10,13-14H2,1-6H3 |
| InChIKey | PCKMDJHOHNSLRJ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 167.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.77 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|