C31H32N2O12S3 — CID 163213518
[5-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl thiophene-2-sulfonate (PubChem CID 163213518) has the molecular formula C31H32N2O12S3 and a molecular weight of 720.80 g/mol. Its IUPAC name is [5-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl thiophene-2-sulfonate.
| Compound Name | [5-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl thiophene-2-sulfonate |
|---|---|
| PubChem CID | 163213518 |
| Molecular Formula | C31H32N2O12S3 |
| Molecular Weight | 720.80 g/mol |
| Exact Mass | 720.11 |
| IUPAC Name | [5-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl thiophene-2-sulfonate |
| SMILES | COc1cc(OC)c2c(=O)c(OCCCCSc3nnc(COS(=O)(=O)c4cccs4)o3)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C31H32N2O12S3/c1-37-19-15-20(38-2)26-21(16-19)44-28(18-13-22(39-3)29(41-5)23(14-18)40-4)30(27(26)34)42-10-6-7-11-47-31-33-32-24(45-31)17-43-48(35,36)25-9-8-12-46-25/h8-9,12-16H,6-7,10-11,17H2,1-5H3 |
| InChIKey | YOTRVJSEPBQHHB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 167.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.80 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|