C30H30N2O12S3 — CID 163213520
[5-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl thiophene-2-sulfonate (PubChem CID 163213520) has the molecular formula C30H30N2O12S3 and a molecular weight of 706.77 g/mol. Its IUPAC name is [5-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl thiophene-2-sulfonate.
| Compound Name | [5-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl thiophene-2-sulfonate |
|---|---|
| PubChem CID | 163213520 |
| Molecular Formula | C30H30N2O12S3 |
| Molecular Weight | 706.77 g/mol |
| Exact Mass | 706.10 |
| IUPAC Name | [5-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl thiophene-2-sulfonate |
| SMILES | COc1cc(OC)c2c(=O)c(OCCCSc3nnc(COS(=O)(=O)c4cccs4)o3)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C30H30N2O12S3/c1-36-18-14-19(37-2)25-20(15-18)43-27(17-12-21(38-3)28(40-5)22(13-17)39-4)29(26(25)33)41-9-7-11-46-30-32-31-23(44-30)16-42-47(34,35)24-8-6-10-45-24/h6,8,10,12-15H,7,9,11,16H2,1-5H3 |
| InChIKey | OZVLWAAQWGUUGR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 167.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.77 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|