C26H22N2O3 — CID 163213576
2-tert-butyl-2'-phenylspiro[3,1-benzoxazine-4,4'-isoquinoline]-1',3'-dione (PubChem CID 163213576) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-tert-butyl-2'-phenylspiro[3,1-benzoxazine-4,4'-isoquinoline]-1',3'-dione.
| Compound Name | 2-tert-butyl-2'-phenylspiro[3,1-benzoxazine-4,4'-isoquinoline]-1',3'-dione |
|---|---|
| PubChem CID | 163213576 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-tert-butyl-2'-phenylspiro[3,1-benzoxazine-4,4'-isoquinoline]-1',3'-dione |
| SMILES | CC(C)(C)C1=Nc2ccccc2C2(O1)C(=O)N(c1ccccc1)C(=O)c1ccccc12 |
| InChI | InChI=1S/C26H22N2O3/c1-25(2,3)23-27-21-16-10-9-15-20(21)26(31-23)19-14-8-7-13-18(19)22(29)28(24(26)30)17-11-5-4-6-12-17/h4-16H,1-3H3 |
| InChIKey | HTHTUPBBTTYRMR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|