C27H23FN4O3 — CID 163213644
ethyl (E)-3-[4-[[4-(4-fluorophenyl)-6-(4-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enoate (PubChem CID 163213644) has the molecular formula C27H23FN4O3 and a molecular weight of 470.50 g/mol. Its IUPAC name is ethyl (E)-3-[4-[[4-(4-fluorophenyl)-6-(4-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[[4-(4-fluorophenyl)-6-(4-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 163213644 |
| Molecular Formula | C27H23FN4O3 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | ethyl (E)-3-[4-[[4-(4-fluorophenyl)-6-(4-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(Nc2nc(-c3ccc(F)cc3)nc(-c3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C27H23FN4O3/c1-3-35-24(33)17-6-18-4-13-22(14-5-18)29-27-31-25(19-7-11-21(28)12-8-19)30-26(32-27)20-9-15-23(34-2)16-10-20/h4-17H,3H2,1-2H3,(H,29,30,31,32)/b17-6+ |
| InChIKey | XNQJLTDUAAWKMX-UBKPWBPPSA-N |
| XLogP | 5.67 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|