C28H25FN4O3 — CID 163213652
ethyl (E)-3-[4-[[4-(4-fluoro-2-methylphenyl)-6-(4-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enoate (PubChem CID 163213652) has the molecular formula C28H25FN4O3 and a molecular weight of 484.53 g/mol. Its IUPAC name is ethyl (E)-3-[4-[[4-(4-fluoro-2-methylphenyl)-6-(4-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[[4-(4-fluoro-2-methylphenyl)-6-(4-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 163213652 |
| Molecular Formula | C28H25FN4O3 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | ethyl (E)-3-[4-[[4-(4-fluoro-2-methylphenyl)-6-(4-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(Nc2nc(-c3ccc(OC)cc3)nc(-c3ccc(F)cc3C)n2)cc1 |
| InChI | InChI=1S/C28H25FN4O3/c1-4-36-25(34)16-7-19-5-11-22(12-6-19)30-28-32-26(20-8-13-23(35-3)14-9-20)31-27(33-28)24-15-10-21(29)17-18(24)2/h5-17H,4H2,1-3H3,(H,30,31,32,33)/b16-7+ |
| InChIKey | DRCBBEBNNRLPEM-FRKPEAEDSA-N |
| XLogP | 5.98 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|