C23H25N7S — CID 163213865
7-(4-cyano-2-pyridinyl)-N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-2,7-diazaspiro[3.5]nonane-2-carbothioamide (PubChem CID 163213865) has the molecular formula C23H25N7S and a molecular weight of 431.57 g/mol. Its IUPAC name is 7-(4-cyano-2-pyridinyl)-N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-2,7-diazaspiro[3.5]nonane-2-carbothioamide.
| Compound Name | 7-(4-cyano-2-pyridinyl)-N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-2,7-diazaspiro[3.5]nonane-2-carbothioamide |
|---|---|
| PubChem CID | 163213865 |
| Molecular Formula | C23H25N7S |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 7-(4-cyano-2-pyridinyl)-N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-2,7-diazaspiro[3.5]nonane-2-carbothioamide |
| SMILES | N#Cc1ccnc(N2CCC3(CC2)CN(C(=S)N/N=C2\CCCc4cccnc42)C3)c1 |
| InChI | InChI=1S/C23H25N7S/c24-14-17-6-10-25-20(13-17)29-11-7-23(8-12-29)15-30(16-23)22(31)28-27-19-5-1-3-18-4-2-9-26-21(18)19/h2,4,6,9-10,13H,1,3,5,7-8,11-12,15-16H2,(H,28,31)/b27-19+ |
| InChIKey | RGGKWEDHUNBOMY-ZXVVBBHZSA-N |
| XLogP | 2.87 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|