C32H39N5O3 — CID 163214365
[2-tert-butyl-1-(8-cyclopentyl-5-ethynyl-7-oxopyrido[2,3-d]pyrimidin-2-yl)piperidin-4-yl] N-(2-phenylethyl)carbamate (PubChem CID 163214365) has the molecular formula C32H39N5O3 and a molecular weight of 541.70 g/mol. Its IUPAC name is [2-tert-butyl-1-(8-cyclopentyl-5-ethynyl-7-oxopyrido[2,3-d]pyrimidin-2-yl)piperidin-4-yl] N-(2-phenylethyl)carbamate.
| Compound Name | [2-tert-butyl-1-(8-cyclopentyl-5-ethynyl-7-oxopyrido[2,3-d]pyrimidin-2-yl)piperidin-4-yl] N-(2-phenylethyl)carbamate |
|---|---|
| PubChem CID | 163214365 |
| Molecular Formula | C32H39N5O3 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | [2-tert-butyl-1-(8-cyclopentyl-5-ethynyl-7-oxopyrido[2,3-d]pyrimidin-2-yl)piperidin-4-yl] N-(2-phenylethyl)carbamate |
| SMILES | C#Cc1cc(=O)n(C2CCCC2)c2nc(N3CCC(OC(=O)NCCc4ccccc4)CC3C(C)(C)C)ncc12 |
| InChI | InChI=1S/C32H39N5O3/c1-5-23-19-28(38)37(24-13-9-10-14-24)29-26(23)21-34-30(35-29)36-18-16-25(20-27(36)32(2,3)4)40-31(39)33-17-15-22-11-7-6-8-12-22/h1,6-8,11-12,19,21,24-25,27H,9-10,13-18,20H2,2-4H3,(H,33,39) |
| InChIKey | OKSNKAXCGAFCLT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|