About (6E)-2-fluoro-6-[(4-fluorophenyl)methylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one
(6E)-2-fluoro-6-[(4-fluorophenyl)methylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one (PubChem CID 163214386) has the molecular formula C19H14F2N2O
and a molecular weight of 324.33 g/mol. Its IUPAC name is (6E)-2-fluoro-6-[(4-fluorophenyl)methylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one.
Molecular Properties
| Compound Name | (6E)-2-fluoro-6-[(4-fluorophenyl)methylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one |
| PubChem CID | 163214386 |
| Molecular Formula | C19H14F2N2O |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (6E)-2-fluoro-6-[(4-fluorophenyl)methylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one |
| SMILES | O=c1c2cc(F)ccc2nc2n1CCC/C2=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C19H14F2N2O/c20-14-5-3-12(4-6-14)10-13-2-1-9-23-18(13)22-17-8-7-15(21)11-16(17)19(23)24/h3-8,10-11H,1-2,9H2/b13-10+ |
| InChIKey | IDWSQTTXAPOUPG-JLHYYAGUSA-N |
| XLogP | 4.01 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6E)-2-fluoro-6-[(4-fluorophenyl)methylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-2-fluoro-6-[(4-fluorophenyl)methylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one?
The IUPAC name of (6E)-2-fluoro-6-[(4-fluorophenyl)methylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one (CID 163214386) is (6E)-2-fluoro-6-[(4-fluorophenyl)methylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one.
What is the SMILES notation for (6E)-2-fluoro-6-[(4-fluorophenyl)methylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one?
The canonical SMILES for (6E)-2-fluoro-6-[(4-fluorophenyl)methylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one is O=c1c2cc(F)ccc2nc2n1CCC/C2=C\c1ccc(F)cc1.
What is the InChIKey of (6E)-2-fluoro-6-[(4-fluorophenyl)methylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one?
The InChIKey is IDWSQTTXAPOUPG-JLHYYAGUSA-N. The full InChI is InChI=1S/C19H14F2N2O/c20-14-5-3-12(4-6-14)10-13-2-1-9-23-18(13)22-17-8-7-15(21)11-16(17)19(23)24/h3-8,10-11H,1-2,9H2/b13-10+.
What are the key properties of (6E)-2-fluoro-6-[(4-fluorophenyl)methylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one?
(6E)-2-fluoro-6-[(4-fluorophenyl)methylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one has a molecular weight of 324.33 g/mol, XLogP of 4.01, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-2-fluoro-6-[(4-fluorophenyl)methylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one is sourced from PubChem (CID 163214386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).