About 1-(4-bromophenyl)-3,5-dinitropyrazole
1-(4-bromophenyl)-3,5-dinitropyrazole (PubChem CID 163214709) has the molecular formula C9H5BrN4O4
and a molecular weight of 313.07 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3,5-dinitropyrazole.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-3,5-dinitropyrazole |
| PubChem CID | 163214709 |
| Molecular Formula | C9H5BrN4O4 |
| Molecular Weight | 313.07 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | 1-(4-bromophenyl)-3,5-dinitropyrazole |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])n(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C9H5BrN4O4/c10-6-1-3-7(4-2-6)12-9(14(17)18)5-8(11-12)13(15)16/h1-5H |
| InChIKey | TWLWRJQQEBIPCU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 104.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.07 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromophenyl)-3,5-dinitropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-3,5-dinitropyrazole?
The IUPAC name of 1-(4-bromophenyl)-3,5-dinitropyrazole (CID 163214709) is 1-(4-bromophenyl)-3,5-dinitropyrazole.
What is the SMILES notation for 1-(4-bromophenyl)-3,5-dinitropyrazole?
The canonical SMILES for 1-(4-bromophenyl)-3,5-dinitropyrazole is O=[N+]([O-])c1cc([N+](=O)[O-])n(-c2ccc(Br)cc2)n1.
What is the InChIKey of 1-(4-bromophenyl)-3,5-dinitropyrazole?
The InChIKey is TWLWRJQQEBIPCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrN4O4/c10-6-1-3-7(4-2-6)12-9(14(17)18)5-8(11-12)13(15)16/h1-5H.
What are the key properties of 1-(4-bromophenyl)-3,5-dinitropyrazole?
1-(4-bromophenyl)-3,5-dinitropyrazole has a molecular weight of 313.07 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-3,5-dinitropyrazole is sourced from PubChem (CID 163214709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).