C24H23N5O3S — CID 163215784
N-[[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]methyl]-4,9-dioxo-[1,3]thiazolo[5,4-g]isoquinoline-2-carboxamide (PubChem CID 163215784) has the molecular formula C24H23N5O3S and a molecular weight of 461.55 g/mol. Its IUPAC name is N-[[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]methyl]-4,9-dioxo-[1,3]thiazolo[5,4-g]isoquinoline-2-carboxamide.
| Compound Name | N-[[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]methyl]-4,9-dioxo-[1,3]thiazolo[5,4-g]isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 163215784 |
| Molecular Formula | C24H23N5O3S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | N-[[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]methyl]-4,9-dioxo-[1,3]thiazolo[5,4-g]isoquinoline-2-carboxamide |
| SMILES | Cc1cc(N2CCN(C)CC2)ccc1CNC(=O)c1nc2c(s1)C(=O)c1ccncc1C2=O |
| InChI | InChI=1S/C24H23N5O3S/c1-14-11-16(29-9-7-28(2)8-10-29)4-3-15(14)12-26-23(32)24-27-19-20(30)18-13-25-6-5-17(18)21(31)22(19)33-24/h3-6,11,13H,7-10,12H2,1-2H3,(H,26,32) |
| InChIKey | XJLQIJVGMFMBFY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|