C16H22BN3O2 — CID 163216441
3-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]pyridine (PubChem CID 163216441) has the molecular formula C16H22BN3O2 and a molecular weight of 299.18 g/mol. Its IUPAC name is 3-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]pyridine.
| Compound Name | 3-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]pyridine |
|---|---|
| PubChem CID | 163216441 |
| Molecular Formula | C16H22BN3O2 |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 3-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]pyridine |
| SMILES | CC(c1cccnc1)n1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C16H22BN3O2/c1-12(13-7-6-8-18-9-13)20-11-14(10-19-20)17-21-15(2,3)16(4,5)22-17/h6-12H,1-5H3 |
| InChIKey | CMFMGOOZIRGACQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|