C24H23F3N4O4 — CID 163216676
4-[[2-methoxy-4-(6-oxo-1,4,5,7-tetrahydropyrazolo[5,4-b]pyridin-4-yl)phenoxy]methyl]-N,N-dimethyl-3-(trifluoromethyl)benzamide (PubChem CID 163216676) has the molecular formula C24H23F3N4O4 and a molecular weight of 488.47 g/mol. Its IUPAC name is 4-[[2-methoxy-4-(6-oxo-1,4,5,7-tetrahydropyrazolo[5,4-b]pyridin-4-yl)phenoxy]methyl]-N,N-dimethyl-3-(trifluoromethyl)benzamide.
| Compound Name | 4-[[2-methoxy-4-(6-oxo-1,4,5,7-tetrahydropyrazolo[5,4-b]pyridin-4-yl)phenoxy]methyl]-N,N-dimethyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 163216676 |
| Molecular Formula | C24H23F3N4O4 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 4-[[2-methoxy-4-(6-oxo-1,4,5,7-tetrahydropyrazolo[5,4-b]pyridin-4-yl)phenoxy]methyl]-N,N-dimethyl-3-(trifluoromethyl)benzamide |
| SMILES | COc1cc(C2CC(=O)Nc3[nH]ncc32)ccc1OCc1ccc(C(=O)N(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C24H23F3N4O4/c1-31(2)23(33)14-4-5-15(18(8-14)24(25,26)27)12-35-19-7-6-13(9-20(19)34-3)16-10-21(32)29-22-17(16)11-28-30-22/h4-9,11,16H,10,12H2,1-3H3,(H2,28,29,30,32) |
| InChIKey | GVNZSYVQAHFGLX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |