About methyl 2-fluoro-5-[[(3S)-4-methylmorpholin-3-yl]methoxy]-3-(5-methyl-1,3-thiazol-2-yl)benzoate
methyl 2-fluoro-5-[[(3S)-4-methylmorpholin-3-yl]methoxy]-3-(5-methyl-1,3-thiazol-2-yl)benzoate (PubChem CID 163216916) has the molecular formula C18H21FN2O4S
and a molecular weight of 380.44 g/mol. Its IUPAC name is methyl 2-fluoro-5-[[(3S)-4-methylmorpholin-3-yl]methoxy]-3-(5-methyl-1,3-thiazol-2-yl)benzoate.
Molecular Properties
| Compound Name | methyl 2-fluoro-5-[[(3S)-4-methylmorpholin-3-yl]methoxy]-3-(5-methyl-1,3-thiazol-2-yl)benzoate |
| PubChem CID | 163216916 |
| Molecular Formula | C18H21FN2O4S |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | methyl 2-fluoro-5-[[(3S)-4-methylmorpholin-3-yl]methoxy]-3-(5-methyl-1,3-thiazol-2-yl)benzoate |
| SMILES | COC(=O)c1cc(OC[C@@H]2COCCN2C)cc(-c2ncc(C)s2)c1F |
| InChI | InChI=1S/C18H21FN2O4S/c1-11-8-20-17(26-11)14-6-13(7-15(16(14)19)18(22)23-3)25-10-12-9-24-5-4-21(12)2/h6-8,12H,4-5,9-10H2,1-3H3/t12-/m0/s1 |
| InChIKey | KKNBPWWXHMTRGY-LBPRGKRZSA-N |
| XLogP | 2.75 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-fluoro-5-[[(3S)-4-methylmorpholin-3-yl]methoxy]-3-(5-methyl-1,3-thiazol-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-fluoro-5-[[(3S)-4-methylmorpholin-3-yl]methoxy]-3-(5-methyl-1,3-thiazol-2-yl)benzoate?
The IUPAC name of methyl 2-fluoro-5-[[(3S)-4-methylmorpholin-3-yl]methoxy]-3-(5-methyl-1,3-thiazol-2-yl)benzoate (CID 163216916) is methyl 2-fluoro-5-[[(3S)-4-methylmorpholin-3-yl]methoxy]-3-(5-methyl-1,3-thiazol-2-yl)benzoate.
What is the SMILES notation for methyl 2-fluoro-5-[[(3S)-4-methylmorpholin-3-yl]methoxy]-3-(5-methyl-1,3-thiazol-2-yl)benzoate?
The canonical SMILES for methyl 2-fluoro-5-[[(3S)-4-methylmorpholin-3-yl]methoxy]-3-(5-methyl-1,3-thiazol-2-yl)benzoate is COC(=O)c1cc(OC[C@@H]2COCCN2C)cc(-c2ncc(C)s2)c1F.
What is the InChIKey of methyl 2-fluoro-5-[[(3S)-4-methylmorpholin-3-yl]methoxy]-3-(5-methyl-1,3-thiazol-2-yl)benzoate?
The InChIKey is KKNBPWWXHMTRGY-LBPRGKRZSA-N. The full InChI is InChI=1S/C18H21FN2O4S/c1-11-8-20-17(26-11)14-6-13(7-15(16(14)19)18(22)23-3)25-10-12-9-24-5-4-21(12)2/h6-8,12H,4-5,9-10H2,1-3H3/t12-/m0/s1.
What are the key properties of methyl 2-fluoro-5-[[(3S)-4-methylmorpholin-3-yl]methoxy]-3-(5-methyl-1,3-thiazol-2-yl)benzoate?
methyl 2-fluoro-5-[[(3S)-4-methylmorpholin-3-yl]methoxy]-3-(5-methyl-1,3-thiazol-2-yl)benzoate has a molecular weight of 380.44 g/mol, XLogP of 2.75, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-fluoro-5-[[(3S)-4-methylmorpholin-3-yl]methoxy]-3-(5-methyl-1,3-thiazol-2-yl)benzoate is sourced from PubChem (CID 163216916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).