About 2-bromo-6-chloro-9,9-dimethylxanthene
2-bromo-6-chloro-9,9-dimethylxanthene (PubChem CID 163217021) has the molecular formula C15H12BrClO
and a molecular weight of 323.62 g/mol. Its IUPAC name is 2-bromo-6-chloro-9,9-dimethylxanthene.
Molecular Properties
| Compound Name | 2-bromo-6-chloro-9,9-dimethylxanthene |
| PubChem CID | 163217021 |
| Molecular Formula | C15H12BrClO |
| Molecular Weight | 323.62 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 2-bromo-6-chloro-9,9-dimethylxanthene |
| SMILES | CC1(C)c2ccc(Cl)cc2Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C15H12BrClO/c1-15(2)11-5-4-10(17)8-14(11)18-13-6-3-9(16)7-12(13)15/h3-8H,1-2H3 |
| InChIKey | VAEOOYWAVCLBOG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-6-chloro-9,9-dimethylxanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-chloro-9,9-dimethylxanthene?
The IUPAC name of 2-bromo-6-chloro-9,9-dimethylxanthene (CID 163217021) is 2-bromo-6-chloro-9,9-dimethylxanthene.
What is the SMILES notation for 2-bromo-6-chloro-9,9-dimethylxanthene?
The canonical SMILES for 2-bromo-6-chloro-9,9-dimethylxanthene is CC1(C)c2ccc(Cl)cc2Oc2ccc(Br)cc21.
What is the InChIKey of 2-bromo-6-chloro-9,9-dimethylxanthene?
The InChIKey is VAEOOYWAVCLBOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrClO/c1-15(2)11-5-4-10(17)8-14(11)18-13-6-3-9(16)7-12(13)15/h3-8H,1-2H3.
What are the key properties of 2-bromo-6-chloro-9,9-dimethylxanthene?
2-bromo-6-chloro-9,9-dimethylxanthene has a molecular weight of 323.62 g/mol, XLogP of 5.53, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-chloro-9,9-dimethylxanthene is sourced from PubChem (CID 163217021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).