About 2-(2,4-dimethoxyphenyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1H-imidazole-5-carboxamide
2-(2,4-dimethoxyphenyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1H-imidazole-5-carboxamide (PubChem CID 163217043) has the molecular formula C19H26N4O5
and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1H-imidazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-(2,4-dimethoxyphenyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1H-imidazole-5-carboxamide |
| PubChem CID | 163217043 |
| Molecular Formula | C19H26N4O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1H-imidazole-5-carboxamide |
| SMILES | COc1ccc(-c2ncc(C(=O)NCCCCCCC(=O)NO)[nH]2)c(OC)c1 |
| InChI | InChI=1S/C19H26N4O5/c1-27-13-8-9-14(16(11-13)28-2)18-21-12-15(22-18)19(25)20-10-6-4-3-5-7-17(24)23-26/h8-9,11-12,26H,3-7,10H2,1-2H3,(H,20,25)(H,21,22)(H,23,24) |
| InChIKey | ZKSQKXYNAYAFIG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dimethoxyphenyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1H-imidazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethoxyphenyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1H-imidazole-5-carboxamide?
The IUPAC name of 2-(2,4-dimethoxyphenyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1H-imidazole-5-carboxamide (CID 163217043) is 2-(2,4-dimethoxyphenyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1H-imidazole-5-carboxamide.
What is the SMILES notation for 2-(2,4-dimethoxyphenyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1H-imidazole-5-carboxamide?
The canonical SMILES for 2-(2,4-dimethoxyphenyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1H-imidazole-5-carboxamide is COc1ccc(-c2ncc(C(=O)NCCCCCCC(=O)NO)[nH]2)c(OC)c1.
What is the InChIKey of 2-(2,4-dimethoxyphenyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1H-imidazole-5-carboxamide?
The InChIKey is ZKSQKXYNAYAFIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N4O5/c1-27-13-8-9-14(16(11-13)28-2)18-21-12-15(22-18)19(25)20-10-6-4-3-5-7-17(24)23-26/h8-9,11-12,26H,3-7,10H2,1-2H3,(H,20,25)(H,21,22)(H,23,24).
What are the key properties of 2-(2,4-dimethoxyphenyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1H-imidazole-5-carboxamide?
2-(2,4-dimethoxyphenyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1H-imidazole-5-carboxamide has a molecular weight of 390.44 g/mol, XLogP of 2.28, 11 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethoxyphenyl)-N-[7-(hydroxyamino)-7-oxoheptyl]-1H-imidazole-5-carboxamide is sourced from PubChem (CID 163217043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).