C28H48O — CID 163217249
4-[3a,6,7-trimethyl-3-(6-methylhept-5-en-2-yl)-2,3,4,5,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-6-yl]butan-2-ol (PubChem CID 163217249) has the molecular formula C28H48O and a molecular weight of 400.69 g/mol. Its IUPAC name is 4-[3a,6,7-trimethyl-3-(6-methylhept-5-en-2-yl)-2,3,4,5,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-6-yl]butan-2-ol.
| Compound Name | 4-[3a,6,7-trimethyl-3-(6-methylhept-5-en-2-yl)-2,3,4,5,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-6-yl]butan-2-ol |
|---|---|
| PubChem CID | 163217249 |
| Molecular Formula | C28H48O |
| Molecular Weight | 400.69 g/mol |
| Exact Mass | 400.37 |
| IUPAC Name | 4-[3a,6,7-trimethyl-3-(6-methylhept-5-en-2-yl)-2,3,4,5,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-6-yl]butan-2-ol |
| SMILES | CC(C)=CCCC(C)C1CCC2C3=C(CCC21C)C(C)(CCC(C)O)C(C)CC3 |
| InChI | InChI=1S/C28H48O/c1-19(2)9-8-10-20(3)24-13-14-25-23-12-11-21(4)27(6,17-15-22(5)29)26(23)16-18-28(24,25)7/h9,20-22,24-25,29H,8,10-18H2,1-7H3 |
| InChIKey | QDSXWZULLWLZJA-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.69 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|