C17H17ClN4O3S — CID 163217377
(12S)-3-[(3-chlorothiophen-2-yl)-hydroxymethyl]-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one (PubChem CID 163217377) has the molecular formula C17H17ClN4O3S and a molecular weight of 392.87 g/mol. Its IUPAC name is (12S)-3-[(3-chlorothiophen-2-yl)-hydroxymethyl]-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one.
| Compound Name | (12S)-3-[(3-chlorothiophen-2-yl)-hydroxymethyl]-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one |
|---|---|
| PubChem CID | 163217377 |
| Molecular Formula | C17H17ClN4O3S |
| Molecular Weight | 392.87 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | (12S)-3-[(3-chlorothiophen-2-yl)-hydroxymethyl]-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one |
| SMILES | COC[C@]1(C)Nc2c(cnc3[nH]cc(C(O)c4sccc4Cl)c23)NC1=O |
| InChI | InChI=1S/C17H17ClN4O3S/c1-17(7-25-2)16(24)21-10-6-20-15-11(12(10)22-17)8(5-19-15)13(23)14-9(18)3-4-26-14/h3-6,13,22-23H,7H2,1-2H3,(H,19,20)(H,21,24)/t13?,17-/m0/s1 |
| InChIKey | VROGPGVQUZZHIN-RUINGEJQSA-N |
| XLogP | 3.13 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.87 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |