C21H24N4O5S — CID 163217378
(12S)-5-(benzenesulfonyl)-10-(2-methoxyethyl)-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one (PubChem CID 163217378) has the molecular formula C21H24N4O5S and a molecular weight of 444.51 g/mol. Its IUPAC name is (12S)-5-(benzenesulfonyl)-10-(2-methoxyethyl)-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one.
| Compound Name | (12S)-5-(benzenesulfonyl)-10-(2-methoxyethyl)-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one |
|---|---|
| PubChem CID | 163217378 |
| Molecular Formula | C21H24N4O5S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | (12S)-5-(benzenesulfonyl)-10-(2-methoxyethyl)-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one |
| SMILES | COCCN1C(=O)[C@](C)(COC)Nc2c1cnc1c2ccn1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24N4O5S/c1-21(14-30-3)20(26)24(11-12-29-2)17-13-22-19-16(18(17)23-21)9-10-25(19)31(27,28)15-7-5-4-6-8-15/h4-10,13,23H,11-12,14H2,1-3H3/t21-/m0/s1 |
| InChIKey | QNRCFFFZFVSUGJ-NRFANRHFSA-N |
| XLogP | 2.08 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |