C29H34N6O2 — CID 163217909
2-methyl-9-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]spiro[2,4,7,13-tetrazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(14),8,10,12,15-pentaene-5,1'-cyclobutane]-3-one (PubChem CID 163217909) has the molecular formula C29H34N6O2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 2-methyl-9-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]spiro[2,4,7,13-tetrazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(14),8,10,12,15-pentaene-5,1'-cyclobutane]-3-one.
| Compound Name | 2-methyl-9-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]spiro[2,4,7,13-tetrazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(14),8,10,12,15-pentaene-5,1'-cyclobutane]-3-one |
|---|---|
| PubChem CID | 163217909 |
| Molecular Formula | C29H34N6O2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 2-methyl-9-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]spiro[2,4,7,13-tetrazatetracyclo[6.6.2.04,15.012,16]hexadeca-1(14),8,10,12,15-pentaene-5,1'-cyclobutane]-3-one |
| SMILES | Cn1c(=O)n2c3c4c(c(-c5ccc(OCCCN6CCCCC6)nc5)ccc4ncc31)NCC21CCC1 |
| InChI | InChI=1S/C29H34N6O2/c1-33-23-18-30-22-9-8-21(26-25(22)27(23)35(28(33)36)29(19-32-26)11-5-12-29)20-7-10-24(31-17-20)37-16-6-15-34-13-3-2-4-14-34/h7-10,17-18,32H,2-6,11-16,19H2,1H3 |
| InChIKey | UNOYSKXBTMCAAY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|