C16H21F3N2 — CID 163218526
N-[[(2S)-pyrrolidin-2-yl]methyl]-1-[3-(trifluoromethyl)phenyl]cyclobutan-1-amine (PubChem CID 163218526) has the molecular formula C16H21F3N2 and a molecular weight of 298.35 g/mol. Its IUPAC name is N-[[(2S)-pyrrolidin-2-yl]methyl]-1-[3-(trifluoromethyl)phenyl]cyclobutan-1-amine.
| Compound Name | N-[[(2S)-pyrrolidin-2-yl]methyl]-1-[3-(trifluoromethyl)phenyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 163218526 |
| Molecular Formula | C16H21F3N2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N-[[(2S)-pyrrolidin-2-yl]methyl]-1-[3-(trifluoromethyl)phenyl]cyclobutan-1-amine |
| SMILES | FC(F)(F)c1cccc(C2(NC[C@@H]3CCCN3)CCC2)c1 |
| InChI | InChI=1S/C16H21F3N2/c17-16(18,19)13-5-1-4-12(10-13)15(7-3-8-15)21-11-14-6-2-9-20-14/h1,4-5,10,14,20-21H,2-3,6-9,11H2/t14-/m0/s1 |
| InChIKey | ZBCPAZJKMZHGBZ-AWEZNQCLSA-N |
| XLogP | 3.43 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |