C16H20F4N2 — CID 163218554
1-[3-fluoro-5-(trifluoromethyl)phenyl]-N-(pyrrolidin-2-ylmethyl)cyclobutan-1-amine (PubChem CID 163218554) has the molecular formula C16H20F4N2 and a molecular weight of 316.34 g/mol. Its IUPAC name is 1-[3-fluoro-5-(trifluoromethyl)phenyl]-N-(pyrrolidin-2-ylmethyl)cyclobutan-1-amine.
| Compound Name | 1-[3-fluoro-5-(trifluoromethyl)phenyl]-N-(pyrrolidin-2-ylmethyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 163218554 |
| Molecular Formula | C16H20F4N2 |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-[3-fluoro-5-(trifluoromethyl)phenyl]-N-(pyrrolidin-2-ylmethyl)cyclobutan-1-amine |
| SMILES | Fc1cc(C(F)(F)F)cc(C2(NCC3CCCN3)CCC2)c1 |
| InChI | InChI=1S/C16H20F4N2/c17-13-8-11(7-12(9-13)16(18,19)20)15(4-2-5-15)22-10-14-3-1-6-21-14/h7-9,14,21-22H,1-6,10H2 |
| InChIKey | NHRJVZKOYMLSOA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |