About 2-bromo-2,5-dimethyl-3-(trifluoromethyl)-1H-pyridine
2-bromo-2,5-dimethyl-3-(trifluoromethyl)-1H-pyridine (PubChem CID 163218583) has the molecular formula C8H9BrF3N
and a molecular weight of 256.06 g/mol. Its IUPAC name is 2-bromo-2,5-dimethyl-3-(trifluoromethyl)-1H-pyridine.
Molecular Properties
| Compound Name | 2-bromo-2,5-dimethyl-3-(trifluoromethyl)-1H-pyridine |
| PubChem CID | 163218583 |
| Molecular Formula | C8H9BrF3N |
| Molecular Weight | 256.06 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 2-bromo-2,5-dimethyl-3-(trifluoromethyl)-1H-pyridine |
| SMILES | CC1=CNC(C)(Br)C(C(F)(F)F)=C1 |
| InChI | InChI=1S/C8H9BrF3N/c1-5-3-6(8(10,11)12)7(2,9)13-4-5/h3-4,13H,1-2H3 |
| InChIKey | QJMUQYRXXIOFFV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.06 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-2,5-dimethyl-3-(trifluoromethyl)-1H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-2,5-dimethyl-3-(trifluoromethyl)-1H-pyridine?
The IUPAC name of 2-bromo-2,5-dimethyl-3-(trifluoromethyl)-1H-pyridine (CID 163218583) is 2-bromo-2,5-dimethyl-3-(trifluoromethyl)-1H-pyridine.
What is the SMILES notation for 2-bromo-2,5-dimethyl-3-(trifluoromethyl)-1H-pyridine?
The canonical SMILES for 2-bromo-2,5-dimethyl-3-(trifluoromethyl)-1H-pyridine is CC1=CNC(C)(Br)C(C(F)(F)F)=C1.
What is the InChIKey of 2-bromo-2,5-dimethyl-3-(trifluoromethyl)-1H-pyridine?
The InChIKey is QJMUQYRXXIOFFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrF3N/c1-5-3-6(8(10,11)12)7(2,9)13-4-5/h3-4,13H,1-2H3.
What are the key properties of 2-bromo-2,5-dimethyl-3-(trifluoromethyl)-1H-pyridine?
2-bromo-2,5-dimethyl-3-(trifluoromethyl)-1H-pyridine has a molecular weight of 256.06 g/mol, XLogP of 3.09, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-2,5-dimethyl-3-(trifluoromethyl)-1H-pyridine is sourced from PubChem (CID 163218583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).