C21H30 — CID 163218788
1-(7,7-dimethyl-5-methylidenenona-1,8-dien-2-yl)-2,4,5-trimethylbenzene (PubChem CID 163218788) has the molecular formula C21H30 and a molecular weight of 282.47 g/mol. Its IUPAC name is 1-(7,7-dimethyl-5-methylidenenona-1,8-dien-2-yl)-2,4,5-trimethylbenzene.
| Compound Name | 1-(7,7-dimethyl-5-methylidenenona-1,8-dien-2-yl)-2,4,5-trimethylbenzene |
|---|---|
| PubChem CID | 163218788 |
| Molecular Formula | C21H30 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 1-(7,7-dimethyl-5-methylidenenona-1,8-dien-2-yl)-2,4,5-trimethylbenzene |
| SMILES | C=CC(C)(C)CC(=C)CCC(=C)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C21H30/c1-9-21(7,8)14-15(2)10-11-16(3)20-13-18(5)17(4)12-19(20)6/h9,12-13H,1-3,10-11,14H2,4-8H3 |
| InChIKey | BTZWRQFERIHRJJ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|