About carbanide;1-methanimidoyl-4-propan-2-ylpyridin-2-imine;rubidium(1+)
carbanide;1-methanimidoyl-4-propan-2-ylpyridin-2-imine;rubidium(1+) (PubChem CID 163219188) has the molecular formula C10H16N3Rb
and a molecular weight of 263.73 g/mol. Its IUPAC name is carbanide;1-methanimidoyl-4-propan-2-ylpyridin-2-imine;rubidium(1+).
Molecular Properties
| Compound Name | carbanide;1-methanimidoyl-4-propan-2-ylpyridin-2-imine;rubidium(1+) |
| PubChem CID | 163219188 |
| Molecular Formula | C10H16N3Rb |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | carbanide;1-methanimidoyl-4-propan-2-ylpyridin-2-imine;rubidium(1+) |
| SMILES | [CH3-].[H]/N=C/n1ccc(C(C)C)c/c1=N\[H].[Rb+] |
| InChI | InChI=1S/C9H13N3.CH3.Rb/c1-7(2)8-3-4-12(6-10)9(11)5-8;;/h3-7,10-11H,1-2H3;1H3;/q;-1;+1/b10-6+,11-9+;; |
| InChIKey | HTRFPLOTHZKYQA-XPUPCMNESA-N |
| XLogP | -1.00 |
| TPSA | 52.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze carbanide;1-methanimidoyl-4-propan-2-ylpyridin-2-imine;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;1-methanimidoyl-4-propan-2-ylpyridin-2-imine;rubidium(1+)?
The IUPAC name of carbanide;1-methanimidoyl-4-propan-2-ylpyridin-2-imine;rubidium(1+) (CID 163219188) is carbanide;1-methanimidoyl-4-propan-2-ylpyridin-2-imine;rubidium(1+).
What is the SMILES notation for carbanide;1-methanimidoyl-4-propan-2-ylpyridin-2-imine;rubidium(1+)?
The canonical SMILES for carbanide;1-methanimidoyl-4-propan-2-ylpyridin-2-imine;rubidium(1+) is [CH3-].[H]/N=C/n1ccc(C(C)C)c/c1=N\[H].[Rb+].
What is the InChIKey of carbanide;1-methanimidoyl-4-propan-2-ylpyridin-2-imine;rubidium(1+)?
The InChIKey is HTRFPLOTHZKYQA-XPUPCMNESA-N. The full InChI is InChI=1S/C9H13N3.CH3.Rb/c1-7(2)8-3-4-12(6-10)9(11)5-8;;/h3-7,10-11H,1-2H3;1H3;/q;-1;+1/b10-6+,11-9+;;.
What are the key properties of carbanide;1-methanimidoyl-4-propan-2-ylpyridin-2-imine;rubidium(1+)?
carbanide;1-methanimidoyl-4-propan-2-ylpyridin-2-imine;rubidium(1+) has a molecular weight of 263.73 g/mol, XLogP of -1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;1-methanimidoyl-4-propan-2-ylpyridin-2-imine;rubidium(1+) is sourced from PubChem (CID 163219188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).