About ethyl 2-(2,2-difluorocyclopropyl)-4-(2-methylpropanoyl)-1,3-thiazole-5-carboxylate
ethyl 2-(2,2-difluorocyclopropyl)-4-(2-methylpropanoyl)-1,3-thiazole-5-carboxylate (PubChem CID 163219382) has the molecular formula C13H15F2NO3S
and a molecular weight of 303.33 g/mol. Its IUPAC name is ethyl 2-(2,2-difluorocyclopropyl)-4-(2-methylpropanoyl)-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(2,2-difluorocyclopropyl)-4-(2-methylpropanoyl)-1,3-thiazole-5-carboxylate |
| PubChem CID | 163219382 |
| Molecular Formula | C13H15F2NO3S |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | ethyl 2-(2,2-difluorocyclopropyl)-4-(2-methylpropanoyl)-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(C2CC2(F)F)nc1C(=O)C(C)C |
| InChI | InChI=1S/C13H15F2NO3S/c1-4-19-12(18)10-8(9(17)6(2)3)16-11(20-10)7-5-13(7,14)15/h6-7H,4-5H2,1-3H3 |
| InChIKey | RDCJXIYTDFNXBU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(2,2-difluorocyclopropyl)-4-(2-methylpropanoyl)-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2,2-difluorocyclopropyl)-4-(2-methylpropanoyl)-1,3-thiazole-5-carboxylate?
The IUPAC name of ethyl 2-(2,2-difluorocyclopropyl)-4-(2-methylpropanoyl)-1,3-thiazole-5-carboxylate (CID 163219382) is ethyl 2-(2,2-difluorocyclopropyl)-4-(2-methylpropanoyl)-1,3-thiazole-5-carboxylate.
What is the SMILES notation for ethyl 2-(2,2-difluorocyclopropyl)-4-(2-methylpropanoyl)-1,3-thiazole-5-carboxylate?
The canonical SMILES for ethyl 2-(2,2-difluorocyclopropyl)-4-(2-methylpropanoyl)-1,3-thiazole-5-carboxylate is CCOC(=O)c1sc(C2CC2(F)F)nc1C(=O)C(C)C.
What is the InChIKey of ethyl 2-(2,2-difluorocyclopropyl)-4-(2-methylpropanoyl)-1,3-thiazole-5-carboxylate?
The InChIKey is RDCJXIYTDFNXBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2NO3S/c1-4-19-12(18)10-8(9(17)6(2)3)16-11(20-10)7-5-13(7,14)15/h6-7H,4-5H2,1-3H3.
What are the key properties of ethyl 2-(2,2-difluorocyclopropyl)-4-(2-methylpropanoyl)-1,3-thiazole-5-carboxylate?
ethyl 2-(2,2-difluorocyclopropyl)-4-(2-methylpropanoyl)-1,3-thiazole-5-carboxylate has a molecular weight of 303.33 g/mol, XLogP of 3.28, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2,2-difluorocyclopropyl)-4-(2-methylpropanoyl)-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 163219382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).