About 3-chloro-7-methyl-2,6-naphthyridine
3-chloro-7-methyl-2,6-naphthyridine (PubChem CID 163219656) has the molecular formula C9H7ClN2
and a molecular weight of 178.62 g/mol. Its IUPAC name is 3-chloro-7-methyl-2,6-naphthyridine.
Molecular Properties
| Compound Name | 3-chloro-7-methyl-2,6-naphthyridine |
| PubChem CID | 163219656 |
| Molecular Formula | C9H7ClN2 |
| Molecular Weight | 178.62 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 3-chloro-7-methyl-2,6-naphthyridine |
| SMILES | Cc1cc2cnc(Cl)cc2cn1 |
| InChI | InChI=1S/C9H7ClN2/c1-6-2-7-5-12-9(10)3-8(7)4-11-6/h2-5H,1H3 |
| InChIKey | YUMYHXXRMKQWSO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.62 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-7-methyl-2,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-7-methyl-2,6-naphthyridine?
The IUPAC name of 3-chloro-7-methyl-2,6-naphthyridine (CID 163219656) is 3-chloro-7-methyl-2,6-naphthyridine.
What is the SMILES notation for 3-chloro-7-methyl-2,6-naphthyridine?
The canonical SMILES for 3-chloro-7-methyl-2,6-naphthyridine is Cc1cc2cnc(Cl)cc2cn1.
What is the InChIKey of 3-chloro-7-methyl-2,6-naphthyridine?
The InChIKey is YUMYHXXRMKQWSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2/c1-6-2-7-5-12-9(10)3-8(7)4-11-6/h2-5H,1H3.
What are the key properties of 3-chloro-7-methyl-2,6-naphthyridine?
3-chloro-7-methyl-2,6-naphthyridine has a molecular weight of 178.62 g/mol, XLogP of 2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-7-methyl-2,6-naphthyridine is sourced from PubChem (CID 163219656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).