About 1-cyclopentyl-3-methyl-6-(pyridin-4-ylamino)imidazo[4,5-c]pyridin-2-one
1-cyclopentyl-3-methyl-6-(pyridin-4-ylamino)imidazo[4,5-c]pyridin-2-one (PubChem CID 163219966) has the molecular formula C17H19N5O
and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-cyclopentyl-3-methyl-6-(pyridin-4-ylamino)imidazo[4,5-c]pyridin-2-one.
Molecular Properties
| Compound Name | 1-cyclopentyl-3-methyl-6-(pyridin-4-ylamino)imidazo[4,5-c]pyridin-2-one |
| PubChem CID | 163219966 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 1-cyclopentyl-3-methyl-6-(pyridin-4-ylamino)imidazo[4,5-c]pyridin-2-one |
| SMILES | Cn1c(=O)n(C2CCCC2)c2cc(Nc3ccncc3)ncc21 |
| InChI | InChI=1S/C17H19N5O/c1-21-15-11-19-16(20-12-6-8-18-9-7-12)10-14(15)22(17(21)23)13-4-2-3-5-13/h6-11,13H,2-5H2,1H3,(H,18,19,20) |
| InChIKey | UYGXIUFVBFNVFE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-cyclopentyl-3-methyl-6-(pyridin-4-ylamino)imidazo[4,5-c]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-3-methyl-6-(pyridin-4-ylamino)imidazo[4,5-c]pyridin-2-one?
The IUPAC name of 1-cyclopentyl-3-methyl-6-(pyridin-4-ylamino)imidazo[4,5-c]pyridin-2-one (CID 163219966) is 1-cyclopentyl-3-methyl-6-(pyridin-4-ylamino)imidazo[4,5-c]pyridin-2-one.
What is the SMILES notation for 1-cyclopentyl-3-methyl-6-(pyridin-4-ylamino)imidazo[4,5-c]pyridin-2-one?
The canonical SMILES for 1-cyclopentyl-3-methyl-6-(pyridin-4-ylamino)imidazo[4,5-c]pyridin-2-one is Cn1c(=O)n(C2CCCC2)c2cc(Nc3ccncc3)ncc21.
What is the InChIKey of 1-cyclopentyl-3-methyl-6-(pyridin-4-ylamino)imidazo[4,5-c]pyridin-2-one?
The InChIKey is UYGXIUFVBFNVFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5O/c1-21-15-11-19-16(20-12-6-8-18-9-7-12)10-14(15)22(17(21)23)13-4-2-3-5-13/h6-11,13H,2-5H2,1H3,(H,18,19,20).
What are the key properties of 1-cyclopentyl-3-methyl-6-(pyridin-4-ylamino)imidazo[4,5-c]pyridin-2-one?
1-cyclopentyl-3-methyl-6-(pyridin-4-ylamino)imidazo[4,5-c]pyridin-2-one has a molecular weight of 309.37 g/mol, XLogP of 2.99, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-3-methyl-6-(pyridin-4-ylamino)imidazo[4,5-c]pyridin-2-one is sourced from PubChem (CID 163219966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).