About 1,3-dicyclopentyl-6-(4-methoxy-2-methylanilino)imidazo[4,5-c]pyridin-2-one
1,3-dicyclopentyl-6-(4-methoxy-2-methylanilino)imidazo[4,5-c]pyridin-2-one (PubChem CID 163220211) has the molecular formula C24H30N4O2
and a molecular weight of 406.53 g/mol. Its IUPAC name is 1,3-dicyclopentyl-6-(4-methoxy-2-methylanilino)imidazo[4,5-c]pyridin-2-one.
Molecular Properties
| Compound Name | 1,3-dicyclopentyl-6-(4-methoxy-2-methylanilino)imidazo[4,5-c]pyridin-2-one |
| PubChem CID | 163220211 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 1,3-dicyclopentyl-6-(4-methoxy-2-methylanilino)imidazo[4,5-c]pyridin-2-one |
| SMILES | COc1ccc(Nc2cc3c(cn2)n(C2CCCC2)c(=O)n3C2CCCC2)c(C)c1 |
| InChI | InChI=1S/C24H30N4O2/c1-16-13-19(30-2)11-12-20(16)26-23-14-21-22(15-25-23)28(18-9-5-6-10-18)24(29)27(21)17-7-3-4-8-17/h11-15,17-18H,3-10H2,1-2H3,(H,25,26) |
| InChIKey | RIINOZOVUUXHFK-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,3-dicyclopentyl-6-(4-methoxy-2-methylanilino)imidazo[4,5-c]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dicyclopentyl-6-(4-methoxy-2-methylanilino)imidazo[4,5-c]pyridin-2-one?
The IUPAC name of 1,3-dicyclopentyl-6-(4-methoxy-2-methylanilino)imidazo[4,5-c]pyridin-2-one (CID 163220211) is 1,3-dicyclopentyl-6-(4-methoxy-2-methylanilino)imidazo[4,5-c]pyridin-2-one.
What is the SMILES notation for 1,3-dicyclopentyl-6-(4-methoxy-2-methylanilino)imidazo[4,5-c]pyridin-2-one?
The canonical SMILES for 1,3-dicyclopentyl-6-(4-methoxy-2-methylanilino)imidazo[4,5-c]pyridin-2-one is COc1ccc(Nc2cc3c(cn2)n(C2CCCC2)c(=O)n3C2CCCC2)c(C)c1.
What is the InChIKey of 1,3-dicyclopentyl-6-(4-methoxy-2-methylanilino)imidazo[4,5-c]pyridin-2-one?
The InChIKey is RIINOZOVUUXHFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N4O2/c1-16-13-19(30-2)11-12-20(16)26-23-14-21-22(15-25-23)28(18-9-5-6-10-18)24(29)27(21)17-7-3-4-8-17/h11-15,17-18H,3-10H2,1-2H3,(H,25,26).
What are the key properties of 1,3-dicyclopentyl-6-(4-methoxy-2-methylanilino)imidazo[4,5-c]pyridin-2-one?
1,3-dicyclopentyl-6-(4-methoxy-2-methylanilino)imidazo[4,5-c]pyridin-2-one has a molecular weight of 406.53 g/mol, XLogP of 5.49, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dicyclopentyl-6-(4-methoxy-2-methylanilino)imidazo[4,5-c]pyridin-2-one is sourced from PubChem (CID 163220211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).