C14H8BrFN6O — CID 163220438
N-[6-(5-bromo-6-fluoro-1H-indazol-4-yl)imidazo[1,2-a]pyrazin-2-yl]formamide (PubChem CID 163220438) has the molecular formula C14H8BrFN6O and a molecular weight of 375.16 g/mol. Its IUPAC name is N-[6-(5-bromo-6-fluoro-1H-indazol-4-yl)imidazo[1,2-a]pyrazin-2-yl]formamide.
| Compound Name | N-[6-(5-bromo-6-fluoro-1H-indazol-4-yl)imidazo[1,2-a]pyrazin-2-yl]formamide |
|---|---|
| PubChem CID | 163220438 |
| Molecular Formula | C14H8BrFN6O |
| Molecular Weight | 375.16 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | N-[6-(5-bromo-6-fluoro-1H-indazol-4-yl)imidazo[1,2-a]pyrazin-2-yl]formamide |
| SMILES | O=CNc1cn2cc(-c3c(Br)c(F)cc4[nH]ncc34)ncc2n1 |
| InChI | InChI=1S/C14H8BrFN6O/c15-14-8(16)1-9-7(2-19-21-9)13(14)10-4-22-5-11(18-6-23)20-12(22)3-17-10/h1-6H,(H,18,23)(H,19,21) |
| InChIKey | LLXHSOLRQGLVID-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.16 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|