C19H29N7O2 — CID 163221712
3-amino-6-[1-[1-(6-aminohexyl)piperidin-4-yl]pyrazol-4-yl]pyrazine-2-carboxylic acid (PubChem CID 163221712) has the molecular formula C19H29N7O2 and a molecular weight of 387.49 g/mol. Its IUPAC name is 3-amino-6-[1-[1-(6-aminohexyl)piperidin-4-yl]pyrazol-4-yl]pyrazine-2-carboxylic acid.
| Compound Name | 3-amino-6-[1-[1-(6-aminohexyl)piperidin-4-yl]pyrazol-4-yl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 163221712 |
| Molecular Formula | C19H29N7O2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 3-amino-6-[1-[1-(6-aminohexyl)piperidin-4-yl]pyrazol-4-yl]pyrazine-2-carboxylic acid |
| SMILES | NCCCCCCN1CCC(n2cc(-c3cnc(N)c(C(=O)O)n3)cn2)CC1 |
| InChI | InChI=1S/C19H29N7O2/c20-7-3-1-2-4-8-25-9-5-15(6-10-25)26-13-14(11-23-26)16-12-22-18(21)17(24-16)19(27)28/h11-13,15H,1-10,20H2,(H2,21,22)(H,27,28) |
| InChIKey | HMWPHEPQVQNSHG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|