C32H41N3O3 — CID 163222420
2-amino-3-[(1R)-6-[4-[(4S)-2,2-dimethyl-3,4-dihydrochromen-4-yl]butanoyl]-2,2-dimethyl-1,3-dihydroinden-1-yl]-6,6-dimethyl-5H-pyrimidin-4-one (PubChem CID 163222420) has the molecular formula C32H41N3O3 and a molecular weight of 515.70 g/mol. Its IUPAC name is 2-amino-3-[(1R)-6-[4-[(4S)-2,2-dimethyl-3,4-dihydrochromen-4-yl]butanoyl]-2,2-dimethyl-1,3-dihydroinden-1-yl]-6,6-dimethyl-5H-pyrimidin-4-one.
| Compound Name | 2-amino-3-[(1R)-6-[4-[(4S)-2,2-dimethyl-3,4-dihydrochromen-4-yl]butanoyl]-2,2-dimethyl-1,3-dihydroinden-1-yl]-6,6-dimethyl-5H-pyrimidin-4-one |
|---|---|
| PubChem CID | 163222420 |
| Molecular Formula | C32H41N3O3 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | 2-amino-3-[(1R)-6-[4-[(4S)-2,2-dimethyl-3,4-dihydrochromen-4-yl]butanoyl]-2,2-dimethyl-1,3-dihydroinden-1-yl]-6,6-dimethyl-5H-pyrimidin-4-one |
| SMILES | CC1(C)CC(=O)N([C@H]2c3cc(C(=O)CCC[C@H]4CC(C)(C)Oc5ccccc54)ccc3CC2(C)C)C(N)=N1 |
| InChI | InChI=1S/C32H41N3O3/c1-30(2)17-22-15-14-20(16-24(22)28(30)35-27(37)19-31(3,4)34-29(35)33)25(36)12-9-10-21-18-32(5,6)38-26-13-8-7-11-23(21)26/h7-8,11,13-16,21,28H,9-10,12,17-19H2,1-6H3,(H2,33,34)/t21-,28-/m0/s1 |
| InChIKey | PBXRRNGPOXJYBX-KMRXNPHXSA-N |
| XLogP | 6.33 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |