C24H30N4O3 — CID 163222602
(3R,4S)-4-(diaminomethylideneamino)-3-methyl-N-[(3S,4S)-2,2,3-trimethyl-3,4-dihydrochromen-4-yl]-3,4-dihydro-2H-chromene-6-carboxamide (PubChem CID 163222602) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is (3R,4S)-4-(diaminomethylideneamino)-3-methyl-N-[(3S,4S)-2,2,3-trimethyl-3,4-dihydrochromen-4-yl]-3,4-dihydro-2H-chromene-6-carboxamide.
| Compound Name | (3R,4S)-4-(diaminomethylideneamino)-3-methyl-N-[(3S,4S)-2,2,3-trimethyl-3,4-dihydrochromen-4-yl]-3,4-dihydro-2H-chromene-6-carboxamide |
|---|---|
| PubChem CID | 163222602 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (3R,4S)-4-(diaminomethylideneamino)-3-methyl-N-[(3S,4S)-2,2,3-trimethyl-3,4-dihydrochromen-4-yl]-3,4-dihydro-2H-chromene-6-carboxamide |
| SMILES | C[C@H]1COc2ccc(C(=O)N[C@@H]3c4ccccc4OC(C)(C)[C@H]3C)cc2[C@H]1N=C(N)N |
| InChI | InChI=1S/C24H30N4O3/c1-13-12-30-18-10-9-15(11-17(18)20(13)28-23(25)26)22(29)27-21-14(2)24(3,4)31-19-8-6-5-7-16(19)21/h5-11,13-14,20-21H,12H2,1-4H3,(H,27,29)(H4,25,26,28)/t13-,14-,20-,21-/m0/s1 |
| InChIKey | BTLAEAQNBVBMSO-FJAKRLOMSA-N |
| XLogP | 3.31 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|