C13H19NO4 — CID 163223002
7-O-tert-butyl 2-O-methyl (1S,2R,4S)-7-azabicyclo[2.2.1]hept-5-ene-2,7-dicarboxylate (PubChem CID 163223002) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 7-O-tert-butyl 2-O-methyl (1S,2R,4S)-7-azabicyclo[2.2.1]hept-5-ene-2,7-dicarboxylate.
| Compound Name | 7-O-tert-butyl 2-O-methyl (1S,2R,4S)-7-azabicyclo[2.2.1]hept-5-ene-2,7-dicarboxylate |
|---|---|
| PubChem CID | 163223002 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 7-O-tert-butyl 2-O-methyl (1S,2R,4S)-7-azabicyclo[2.2.1]hept-5-ene-2,7-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H]2C=C[C@@H]1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H19NO4/c1-13(2,3)18-12(16)14-8-5-6-10(14)9(7-8)11(15)17-4/h5-6,8-10H,7H2,1-4H3/t8-,9-,10+/m1/s1 |
| InChIKey | BLJVAMZEPLFSHC-BBBLOLIVSA-N |
| XLogP | 1.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|