C28H36ClN5O — CID 163223330
(E)-1-[1-(5-chloroisoquinolin-4-yl)-5-methyl-3,6-dihydro-2H-pyridin-4-yl]-1-(3,8-diazabicyclo[3.2.1]octan-3-yl)-N-[(Z)-1-methoxypent-1-enyl]methanimine (PubChem CID 163223330) has the molecular formula C28H36ClN5O and a molecular weight of 494.08 g/mol. Its IUPAC name is (E)-1-[1-(5-chloroisoquinolin-4-yl)-5-methyl-3,6-dihydro-2H-pyridin-4-yl]-1-(3,8-diazabicyclo[3.2.1]octan-3-yl)-N-[(Z)-1-methoxypent-1-enyl]methanimine.
| Compound Name | (E)-1-[1-(5-chloroisoquinolin-4-yl)-5-methyl-3,6-dihydro-2H-pyridin-4-yl]-1-(3,8-diazabicyclo[3.2.1]octan-3-yl)-N-[(Z)-1-methoxypent-1-enyl]methanimine |
|---|---|
| PubChem CID | 163223330 |
| Molecular Formula | C28H36ClN5O |
| Molecular Weight | 494.08 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | (E)-1-[1-(5-chloroisoquinolin-4-yl)-5-methyl-3,6-dihydro-2H-pyridin-4-yl]-1-(3,8-diazabicyclo[3.2.1]octan-3-yl)-N-[(Z)-1-methoxypent-1-enyl]methanimine |
| SMILES | CCC/C=C(/N=C(\C1=C(C)CN(c2cncc3cccc(Cl)c23)CC1)N1CC2CCC(C1)N2)OC |
| InChI | InChI=1S/C28H36ClN5O/c1-4-5-9-26(35-3)32-28(34-17-21-10-11-22(18-34)31-21)23-12-13-33(16-19(23)2)25-15-30-14-20-7-6-8-24(29)27(20)25/h6-9,14-15,21-22,31H,4-5,10-13,16-18H2,1-3H3/b26-9-,32-28+ |
| InChIKey | CILKOTCGTFFTKL-NMUKBDNASA-N |
| XLogP | 5.54 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.08 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|