C26H24ClN5O2 — CID 163223668
2-[3-[2-[(1S,3S,5S)-2-azabicyclo[3.1.0]hexan-3-yl]ethynyl]-4-pyridinyl]-3-(3-chloro-2-methoxyanilino)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 163223668) has the molecular formula C26H24ClN5O2 and a molecular weight of 473.96 g/mol. Its IUPAC name is 2-[3-[2-[(1S,3S,5S)-2-azabicyclo[3.1.0]hexan-3-yl]ethynyl]-4-pyridinyl]-3-(3-chloro-2-methoxyanilino)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 2-[3-[2-[(1S,3S,5S)-2-azabicyclo[3.1.0]hexan-3-yl]ethynyl]-4-pyridinyl]-3-(3-chloro-2-methoxyanilino)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 163223668 |
| Molecular Formula | C26H24ClN5O2 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 2-[3-[2-[(1S,3S,5S)-2-azabicyclo[3.1.0]hexan-3-yl]ethynyl]-4-pyridinyl]-3-(3-chloro-2-methoxyanilino)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | COc1c(Cl)cccc1Nc1c(-c2ccncc2C#C[C@@H]2C[C@@H]3C[C@@H]3N2)[nH]c2c1C(=O)NCC2 |
| InChI | InChI=1S/C26H24ClN5O2/c1-34-25-18(27)3-2-4-20(25)32-24-22-19(8-10-29-26(22)33)31-23(24)17-7-9-28-13-14(17)5-6-16-11-15-12-21(15)30-16/h2-4,7,9,13,15-16,21,30-32H,8,10-12H2,1H3,(H,29,33)/t15-,16-,21+/m1/s1 |
| InChIKey | AZCTUOMKEOPLCV-ZOCZFRKYSA-N |
| XLogP | 3.87 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|