C31H33FN6O3 — CID 163224076
(E)-4-(dimethylamino)-N-[1-[2-[4-[3-(3-fluoro-2-methoxyanilino)-4-oxo-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-2-yl]-3-pyridinyl]ethynyl]cyclobutyl]but-2-enamide (PubChem CID 163224076) has the molecular formula C31H33FN6O3 and a molecular weight of 556.64 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-[1-[2-[4-[3-(3-fluoro-2-methoxyanilino)-4-oxo-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-2-yl]-3-pyridinyl]ethynyl]cyclobutyl]but-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-[1-[2-[4-[3-(3-fluoro-2-methoxyanilino)-4-oxo-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-2-yl]-3-pyridinyl]ethynyl]cyclobutyl]but-2-enamide |
|---|---|
| PubChem CID | 163224076 |
| Molecular Formula | C31H33FN6O3 |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | (E)-4-(dimethylamino)-N-[1-[2-[4-[3-(3-fluoro-2-methoxyanilino)-4-oxo-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-2-yl]-3-pyridinyl]ethynyl]cyclobutyl]but-2-enamide |
| SMILES | COc1c(F)cccc1Nc1c(-c2ccncc2C#CC2(NC(=O)/C=C/CN(C)C)CCC2)[nH]c2c1C(=O)NCC2 |
| InChI | InChI=1S/C31H33FN6O3/c1-38(2)18-5-9-25(39)37-31(13-6-14-31)15-10-20-19-33-16-11-21(20)27-28(26-23(35-27)12-17-34-30(26)40)36-24-8-4-7-22(32)29(24)41-3/h4-5,7-9,11,16,19,35-36H,6,12-14,17-18H2,1-3H3,(H,34,40)(H,37,39)/b9-5+ |
| InChIKey | GTHWGTSGOAOLES-WEVVVXLNSA-N |
| XLogP | 3.76 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|