C28H30ClN5O4 — CID 163224230
3-(3-chloro-2-methoxyanilino)-2-[3-[[(2S)-1-prop-2-enoylpiperidin-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 163224230) has the molecular formula C28H30ClN5O4 and a molecular weight of 536.03 g/mol. Its IUPAC name is 3-(3-chloro-2-methoxyanilino)-2-[3-[[(2S)-1-prop-2-enoylpiperidin-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 3-(3-chloro-2-methoxyanilino)-2-[3-[[(2S)-1-prop-2-enoylpiperidin-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 163224230 |
| Molecular Formula | C28H30ClN5O4 |
| Molecular Weight | 536.03 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | 3-(3-chloro-2-methoxyanilino)-2-[3-[[(2S)-1-prop-2-enoylpiperidin-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | C=CC(=O)N1CCCC[C@H]1COc1cnccc1-c1[nH]c2c(c1Nc1cccc(Cl)c1OC)C(=O)NCC2 |
| InChI | InChI=1S/C28H30ClN5O4/c1-3-23(35)34-14-5-4-7-17(34)16-38-22-15-30-12-10-18(22)25-26(24-20(32-25)11-13-31-28(24)36)33-21-9-6-8-19(29)27(21)37-2/h3,6,8-10,12,15,17,32-33H,1,4-5,7,11,13-14,16H2,2H3,(H,31,36)/t17-/m0/s1 |
| InChIKey | UQSYSPWSXCHSBO-KRWDZBQOSA-N |
| XLogP | 4.71 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.03 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|